C12H19FN2O4S2 — CID 113064906
4-fluoro-N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide (PubChem CID 113064906) has the molecular formula C12H19FN2O4S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-fluoro-N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113064906 |
| Molecular Formula | C12H19FN2O4S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-fluoro-N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide |
| SMILES | CCCN(CCNS(=O)(=O)c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H19FN2O4S2/c1-3-9-15(20(2,16)17)10-8-14-21(18,19)12-6-4-11(13)5-7-12/h4-7,14H,3,8-10H2,1-2H3 |
| InChIKey | OBCHNWWVFKXSRJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |