C12H20N2O4S2 — CID 113064904
N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide (PubChem CID 113064904) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113064904 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[2-[methylsulfonyl(propyl)amino]ethyl]benzenesulfonamide |
| SMILES | CCCN(CCNS(=O)(=O)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O4S2/c1-3-10-14(19(2,15)16)11-9-13-20(17,18)12-7-5-4-6-8-12/h4-8,13H,3,9-11H2,1-2H3 |
| InChIKey | IMXCCSGQZDRTEA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |