C13H21ClN2O5S2 — CID 113066109
4-chloro-N-[2-[3-methoxypropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide (PubChem CID 113066109) has the molecular formula C13H21ClN2O5S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 4-chloro-N-[2-[3-methoxypropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[3-methoxypropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113066109 |
| Molecular Formula | C13H21ClN2O5S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 4-chloro-N-[2-[3-methoxypropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide |
| SMILES | COCCCN(CCNS(=O)(=O)c1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H21ClN2O5S2/c1-21-11-3-9-16(22(2,17)18)10-8-15-23(19,20)13-6-4-12(14)5-7-13/h4-7,15H,3,8-11H2,1-2H3 |
| InChIKey | SXIXQKXXTKEAMC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|