C13H21FN2O5S2 — CID 113066025
4-fluoro-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]-3-methylbenzenesulfonamide (PubChem CID 113066025) has the molecular formula C13H21FN2O5S2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 4-fluoro-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113066025 |
| Molecular Formula | C13H21FN2O5S2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-fluoro-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]-3-methylbenzenesulfonamide |
| SMILES | COCCN(CCNS(=O)(=O)c1ccc(F)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C13H21FN2O5S2/c1-11-10-12(4-5-13(11)14)23(19,20)15-6-7-16(8-9-21-2)22(3,17)18/h4-5,10,15H,6-9H2,1-3H3 |
| InChIKey | WTWRSYFANBEAGH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |