C7H18N2O5S2 — CID 113066009
N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]methanesulfonamide (PubChem CID 113066009) has the molecular formula C7H18N2O5S2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113066009 |
| Molecular Formula | C7H18N2O5S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]methanesulfonamide |
| SMILES | COCCN(CCNS(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C7H18N2O5S2/c1-14-7-6-9(16(3,12)13)5-4-8-15(2,10)11/h8H,4-7H2,1-3H3 |
| InChIKey | AOJLPJDWPZVHHK-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |