C10H20N2O6S2 — CID 139970862
2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 139970862) has the molecular formula C10H20N2O6S2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139970862 |
| Molecular Formula | C10H20N2O6S2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CCNS(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C10H20N2O6S2/c1-9(2)10(13)18-8-7-12(20(4,16)17)6-5-11-19(3,14)15/h11H,1,5-8H2,2-4H3 |
| InChIKey | QEHIGPSVUUFSTL-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|