C7H16N2O4S2 — CID 113065281
N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]methanesulfonamide (PubChem CID 113065281) has the molecular formula C7H16N2O4S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113065281 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]methanesulfonamide |
| SMILES | C=CCN(CCNS(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C7H16N2O4S2/c1-4-6-9(15(3,12)13)7-5-8-14(2,10)11/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | NPMHANLLFPAARL-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|