C11H17ClN2O4S2 — CID 113067090
N-[2-[(4-chlorophenyl)methyl-methylsulfonylamino]ethyl]methanesulfonamide (PubChem CID 113067090) has the molecular formula C11H17ClN2O4S2 and a molecular weight of 340.85 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methyl-methylsulfonylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4-chlorophenyl)methyl-methylsulfonylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113067090 |
| Molecular Formula | C11H17ClN2O4S2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methyl-methylsulfonylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN(Cc1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C11H17ClN2O4S2/c1-19(15,16)13-7-8-14(20(2,17)18)9-10-3-5-11(12)6-4-10/h3-6,13H,7-9H2,1-2H3 |
| InChIKey | OSUQJIQZRHVEFC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |