C10H14Cl2N2O4S2 — CID 113071964
N-[2-(2,4-dichloro-N-methylsulfonylanilino)ethyl]methanesulfonamide (PubChem CID 113071964) has the molecular formula C10H14Cl2N2O4S2 and a molecular weight of 361.27 g/mol. Its IUPAC name is N-[2-(2,4-dichloro-N-methylsulfonylanilino)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2,4-dichloro-N-methylsulfonylanilino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113071964 |
| Molecular Formula | C10H14Cl2N2O4S2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | N-[2-(2,4-dichloro-N-methylsulfonylanilino)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN(c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C10H14Cl2N2O4S2/c1-19(15,16)13-5-6-14(20(2,17)18)10-4-3-8(11)7-9(10)12/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | PQHDDWWAOLBQAG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |