C15H13Cl3N2O3S — CID 2712015
N-(2-chlorophenyl)-2-(2,4-dichloro-N-methylsulfonylanilino)acetamide (PubChem CID 2712015) has the molecular formula C15H13Cl3N2O3S and a molecular weight of 407.71 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2,4-dichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(2,4-dichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2712015 |
| Molecular Formula | C15H13Cl3N2O3S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2,4-dichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3N2O3S/c1-24(22,23)20(14-7-6-10(16)8-12(14)18)9-15(21)19-13-5-3-2-4-11(13)17/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | LDFWFPCTSJKJJM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |