C15H11Cl5N2O3S — CID 2233147
N-(2,3-dichlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 2233147) has the molecular formula C15H11Cl5N2O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2233147 |
| Molecular Formula | C15H11Cl5N2O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 473.89 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc(Cl)c1Cl)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl5N2O3S/c1-26(24,25)22(13-6-10(18)9(17)5-11(13)19)7-14(23)21-12-4-2-3-8(16)15(12)20/h2-6H,7H2,1H3,(H,21,23) |
| InChIKey | QCUJWNVEKOZUKW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|