C17H15Cl3N2O4S — CID 1249861
N-(3-acetylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 1249861) has the molecular formula C17H15Cl3N2O4S and a molecular weight of 449.74 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 1249861 |
| Molecular Formula | C17H15Cl3N2O4S |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | N-(3-acetylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H15Cl3N2O4S/c1-10(23)11-4-3-5-12(6-11)21-17(24)9-22(27(2,25)26)16-8-14(19)13(18)7-15(16)20/h3-8H,9H2,1-2H3,(H,21,24) |
| InChIKey | HZUYXLMYIZLXQZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|