C17H16F2N2O4S — CID 113157714
N-(3-acetylphenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide (PubChem CID 113157714) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113157714 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(3-acetylphenyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN(c2ccc(F)c(F)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H16F2N2O4S/c1-11(22)12-4-3-5-13(8-12)20-17(23)10-21(26(2,24)25)14-6-7-15(18)16(19)9-14/h3-9H,10H2,1-2H3,(H,20,23) |
| InChIKey | MGWLRQHXBLQYND-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |