C18H18F2N2O4S — CID 113147280
N-(3-acetylphenyl)-3-(3,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 113147280) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-(3,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(3-acetylphenyl)-3-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113147280 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(3-acetylphenyl)-3-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CCN(c2ccc(F)c(F)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H18F2N2O4S/c1-12(23)13-4-3-5-14(10-13)21-18(24)8-9-22(27(2,25)26)15-6-7-16(19)17(20)11-15/h3-7,10-11H,8-9H2,1-2H3,(H,21,24) |
| InChIKey | FPVUDSDCXAHMIF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |