C18H19ClN2O4S — CID 113143944
N-(3-acetylphenyl)-3-(4-chloro-N-methylsulfonylanilino)propanamide (PubChem CID 113143944) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-(4-chloro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(3-acetylphenyl)-3-(4-chloro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113143944 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-(3-acetylphenyl)-3-(4-chloro-N-methylsulfonylanilino)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CCN(c2ccc(Cl)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-13(22)14-4-3-5-16(12-14)20-18(23)10-11-21(26(2,24)25)17-8-6-15(19)7-9-17/h3-9,12H,10-11H2,1-2H3,(H,20,23) |
| InChIKey | CUNIKIOFBBDRJJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |