C16H15Cl3N2O3S — CID 2223877
N-(3-methylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 2223877) has the molecular formula C16H15Cl3N2O3S and a molecular weight of 421.73 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-methylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2223877 |
| Molecular Formula | C16H15Cl3N2O3S |
| Molecular Weight | 421.73 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | N-(3-methylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1cccc(NC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H15Cl3N2O3S/c1-10-4-3-5-11(6-10)20-16(22)9-21(25(2,23)24)15-8-13(18)12(17)7-14(15)19/h3-8H,9H2,1-2H3,(H,20,22) |
| InChIKey | ASGNDTSEYOIRAT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|