C17H18Cl2N2O3S — CID 1308135
2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3,5-dimethylphenyl)acetamide (PubChem CID 1308135) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 1308135 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CN(c2cc(Cl)ccc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-11-6-12(2)8-14(7-11)20-17(22)10-21(25(3,23)24)16-9-13(18)4-5-15(16)19/h4-9H,10H2,1-3H3,(H,20,22) |
| InChIKey | BUVSBFLZNKOLTL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |