C15H12Cl4N2O3S — CID 3272456
N-(4-chlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 3272456) has the molecular formula C15H12Cl4N2O3S and a molecular weight of 442.15 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3272456 |
| Molecular Formula | C15H12Cl4N2O3S |
| Molecular Weight | 442.15 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(Cl)cc1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl4N2O3S/c1-25(23,24)21(14-7-12(18)11(17)6-13(14)19)8-15(22)20-10-4-2-9(16)3-5-10/h2-7H,8H2,1H3,(H,20,22) |
| InChIKey | PVGOWUUIMLJVKA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.15 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|