C22H19Cl4N3O5S2 — CID 126413055
N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 126413055) has the molecular formula C22H19Cl4N3O5S2 and a molecular weight of 611.36 g/mol. Its IUPAC name is N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126413055 |
| Molecular Formula | C22H19Cl4N3O5S2 |
| Molecular Weight | 611.36 g/mol |
| Exact Mass | 608.95 |
| IUPAC Name | N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1c(Cl)cccc1NS(=O)(=O)c1ccc(NC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H19Cl4N3O5S2/c1-13-16(23)4-3-5-20(13)28-36(33,34)15-8-6-14(7-9-15)27-22(30)12-29(35(2,31)32)21-11-18(25)17(24)10-19(21)26/h3-11,28H,12H2,1-2H3,(H,27,30) |
| InChIKey | KUGWUJZSSPLCLJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.36 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|