C27H23ClN4O7S2 — CID 43882163
2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 43882163) has the molecular formula C27H23ClN4O7S2 and a molecular weight of 615.09 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 43882163 |
| Molecular Formula | C27H23ClN4O7S2 |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1c(Cl)cccc1NS(=O)(=O)c1ccc(NC(=O)CN(c2ccccc2[N+](=O)[O-])S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23ClN4O7S2/c1-19-23(28)10-7-11-24(19)30-40(36,37)21-16-14-20(15-17-21)29-27(33)18-31(25-12-5-6-13-26(25)32(34)35)41(38,39)22-8-3-2-4-9-22/h2-17,30H,18H2,1H3,(H,29,33) |
| InChIKey | QGCGTXWBRXMPLU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|