C26H21ClN4O7S2 — CID 43880254
2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 43880254) has the molecular formula C26H21ClN4O7S2 and a molecular weight of 601.06 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 43880254 |
| Molecular Formula | C26H21ClN4O7S2 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | O=C(CN(c1ccccc1[N+](=O)[O-])S(=O)(=O)c1ccccc1)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H21ClN4O7S2/c27-19-10-12-21(13-11-19)29-39(35,36)22-16-14-20(15-17-22)28-26(32)18-30(24-8-4-5-9-25(24)31(33)34)40(37,38)23-6-2-1-3-7-23/h1-17,29H,18H2,(H,28,32) |
| InChIKey | QIUKGUGKGUDBLF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|