C20H22Cl3N3O3S — CID 100511260
N-(4-piperidin-1-ylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 100511260) has the molecular formula C20H22Cl3N3O3S and a molecular weight of 490.84 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100511260 |
| Molecular Formula | C20H22Cl3N3O3S |
| Molecular Weight | 490.84 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(N2CCCCC2)cc1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl3N3O3S/c1-30(28,29)26(19-12-17(22)16(21)11-18(19)23)13-20(27)24-14-5-7-15(8-6-14)25-9-3-2-4-10-25/h5-8,11-12H,2-4,9-10,13H2,1H3,(H,24,27) |
| InChIKey | LBVNOOJUVHEHIV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|