C14H17Cl3N2O3S — CID 1260940
N-(2-oxo-2-piperidin-1-ylethyl)-N-(2,4,5-trichlorophenyl)methanesulfonamide (PubChem CID 1260940) has the molecular formula C14H17Cl3N2O3S and a molecular weight of 399.73 g/mol. Its IUPAC name is N-(2-oxo-2-piperidin-1-ylethyl)-N-(2,4,5-trichlorophenyl)methanesulfonamide.
| Compound Name | N-(2-oxo-2-piperidin-1-ylethyl)-N-(2,4,5-trichlorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 1260940 |
| Molecular Formula | C14H17Cl3N2O3S |
| Molecular Weight | 399.73 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | N-(2-oxo-2-piperidin-1-ylethyl)-N-(2,4,5-trichlorophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCCCC1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl3N2O3S/c1-23(21,22)19(9-14(20)18-5-3-2-4-6-18)13-8-11(16)10(15)7-12(13)17/h7-8H,2-6,9H2,1H3 |
| InChIKey | MKQYBHODTYEILW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|