C16H21Cl3N2O3S — CID 1249582
N-cycloheptyl-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 1249582) has the molecular formula C16H21Cl3N2O3S and a molecular weight of 427.78 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-cycloheptyl-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 1249582 |
| Molecular Formula | C16H21Cl3N2O3S |
| Molecular Weight | 427.78 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-cycloheptyl-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NC1CCCCCC1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl3N2O3S/c1-25(23,24)21(15-9-13(18)12(17)8-14(15)19)10-16(22)20-11-6-4-2-3-5-7-11/h8-9,11H,2-7,10H2,1H3,(H,20,22) |
| InChIKey | RXWOQBFWZVYMFR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|