C16H22Cl2N2O3S — CID 113156955
N-cycloheptyl-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide (PubChem CID 113156955) has the molecular formula C16H22Cl2N2O3S and a molecular weight of 393.34 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-cycloheptyl-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113156955 |
| Molecular Formula | C16H22Cl2N2O3S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-cycloheptyl-2-(2,6-dichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NC1CCCCCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H22Cl2N2O3S/c1-24(22,23)20(16-13(17)9-6-10-14(16)18)11-15(21)19-12-7-4-2-3-5-8-12/h6,9-10,12H,2-5,7-8,11H2,1H3,(H,19,21) |
| InChIKey | RRPFDHFENCREPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |