C17H25ClN2O4S — CID 2177494
2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-cycloheptylacetamide (PubChem CID 2177494) has the molecular formula C17H25ClN2O4S and a molecular weight of 388.92 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-cycloheptylacetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 2177494 |
| Molecular Formula | C17H25ClN2O4S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-cycloheptylacetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NC1CCCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C17H25ClN2O4S/c1-24-16-10-9-13(18)11-15(16)20(25(2,22)23)12-17(21)19-14-7-5-3-4-6-8-14/h9-11,14H,3-8,12H2,1-2H3,(H,19,21) |
| InChIKey | KTGIDLGVWOITMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |