C15H19F3N2O3S — CID 113157484
N-cyclohexyl-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide (PubChem CID 113157484) has the molecular formula C15H19F3N2O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-cyclohexyl-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113157484 |
| Molecular Formula | C15H19F3N2O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-cyclohexyl-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NC1CCCCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H19F3N2O3S/c1-24(22,23)20(12-8-7-11(16)14(17)15(12)18)9-13(21)19-10-5-3-2-4-6-10/h7-8,10H,2-6,9H2,1H3,(H,19,21) |
| InChIKey | MLCAUUYUPZJRAK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|