C15H18Cl3N3O4S — CID 1251616
1-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]piperidine-4-carboxamide (PubChem CID 1251616) has the molecular formula C15H18Cl3N3O4S and a molecular weight of 442.75 g/mol. Its IUPAC name is 1-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1251616 |
| Molecular Formula | C15H18Cl3N3O4S |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 1-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCC(C(N)=O)CC1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl3N3O4S/c1-26(24,25)21(13-7-11(17)10(16)6-12(13)18)8-14(22)20-4-2-9(3-5-20)15(19)23/h6-7,9H,2-5,8H2,1H3,(H2,19,23) |
| InChIKey | XEODAHVUEAAWMN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|