C18H25ClN2O5S — CID 126032460
ethyl 1-[2-(4-chloro-2-methyl-N-methylsulfonylanilino)acetyl]piperidine-4-carboxylate (PubChem CID 126032460) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is ethyl 1-[2-(4-chloro-2-methyl-N-methylsulfonylanilino)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-chloro-2-methyl-N-methylsulfonylanilino)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 126032460 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | ethyl 1-[2-(4-chloro-2-methyl-N-methylsulfonylanilino)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN(c2ccc(Cl)cc2C)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H25ClN2O5S/c1-4-26-18(23)14-7-9-20(10-8-14)17(22)12-21(27(3,24)25)16-6-5-15(19)11-13(16)2/h5-6,11,14H,4,7-10,12H2,1-3H3 |
| InChIKey | ZWJQJTVIKKYEOT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |