C24H28ClN3O8S — CID 2947419
ethyl 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate (PubChem CID 2947419) has the molecular formula C24H28ClN3O8S and a molecular weight of 554.02 g/mol. Its IUPAC name is ethyl 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2947419 |
| Molecular Formula | C24H28ClN3O8S |
| Molecular Weight | 554.02 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | ethyl 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN(c2cc(Cl)ccc2OC)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C24H28ClN3O8S/c1-4-36-24(30)17-9-11-26(12-10-17)23(29)15-27(21-13-18(25)6-8-22(21)35-3)37(33,34)19-7-5-16(2)20(14-19)28(31)32/h5-8,13-14,17H,4,9-12,15H2,1-3H3 |
| InChIKey | MGEPFXQMGHDIDI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.02 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|