C31H34Cl2N4O7S — CID 125056443
(2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclopentylpropanamide (PubChem CID 125056443) has the molecular formula C31H34Cl2N4O7S and a molecular weight of 677.61 g/mol. Its IUPAC name is (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 125056443 |
| Molecular Formula | C31H34Cl2N4O7S |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclopentylpropanamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N(Cc1ccc(Cl)cc1)[C@H](C)C(=O)NC1CCCC1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H34Cl2N4O7S/c1-20-8-14-26(17-27(20)37(40)41)45(42,43)36(28-16-24(33)13-15-29(28)44-3)19-30(38)35(18-22-9-11-23(32)12-10-22)21(2)31(39)34-25-6-4-5-7-25/h8-17,21,25H,4-7,18-19H2,1-3H3,(H,34,39)/t21-/m1/s1 |
| InChIKey | LFVMWQSAIZTJAA-OAQYLSRUSA-N |
| XLogP | 5.89 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|