C33H39ClN4O8S — CID 100509361
(2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylpropanamide (PubChem CID 100509361) has the molecular formula C33H39ClN4O8S and a molecular weight of 687.22 g/mol. Its IUPAC name is (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylpropanamide.
| Compound Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 100509361 |
| Molecular Formula | C33H39ClN4O8S |
| Molecular Weight | 687.22 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylpropanamide |
| SMILES | COc1cccc(CN(C(=O)CN(c2cc(Cl)ccc2OC)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)[C@@H](C)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C33H39ClN4O8S/c1-22-13-15-28(19-29(22)38(41)42)47(43,44)37(30-18-25(34)14-16-31(30)46-4)21-32(39)36(20-24-9-8-12-27(17-24)45-3)23(2)33(40)35-26-10-6-5-7-11-26/h8-9,12-19,23,26H,5-7,10-11,20-21H2,1-4H3,(H,35,40)/t23-/m0/s1 |
| InChIKey | OCOZCRSVSLQPFY-QHCPKHFHSA-N |
| XLogP | 5.64 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.22 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|