C38H41ClN4O7S — CID 125093650
(2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 125093650) has the molecular formula C38H41ClN4O7S and a molecular weight of 733.29 g/mol. Its IUPAC name is (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 125093650 |
| Molecular Formula | C38H41ClN4O7S |
| Molecular Weight | 733.29 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N(Cc1cccc(C)c1)[C@H](Cc1ccccc1)C(=O)NC1CCCC1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H41ClN4O7S/c1-26-10-9-13-29(20-26)24-41(35(21-28-11-5-4-6-12-28)38(45)40-31-14-7-8-15-31)37(44)25-42(34-22-30(39)17-19-36(34)50-3)51(48,49)32-18-16-27(2)33(23-32)43(46)47/h4-6,9-13,16-20,22-23,31,35H,7-8,14-15,21,24-25H2,1-3H3,(H,40,45)/t35-/m1/s1 |
| InChIKey | LOXCRAAHGWMQAS-PGUFJCEWSA-N |
| XLogP | 6.77 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.29 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|