C38H41ClN4O8S — CID 133261453
2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133261453) has the molecular formula C38H41ClN4O8S and a molecular weight of 749.29 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133261453 |
| Molecular Formula | C38H41ClN4O8S |
| Molecular Weight | 749.29 g/mol |
| Exact Mass | 748.23 |
| IUPAC Name | 2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | COc1cccc(CN(C(=O)CN(c2cc(Cl)ccc2OC)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)C(Cc2ccccc2)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C38H41ClN4O8S/c1-26-16-18-32(23-33(26)43(46)47)52(48,49)42(34-22-29(39)17-19-36(34)51-3)25-37(44)41(24-28-12-9-15-31(20-28)50-2)35(21-27-10-5-4-6-11-27)38(45)40-30-13-7-8-14-30/h4-6,9-12,15-20,22-23,30,35H,7-8,13-14,21,24-25H2,1-3H3,(H,40,45) |
| InChIKey | UNYIZVFFTRFUOQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.29 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|