C36H39ClN4O8S — CID 133201072
2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide (PubChem CID 133201072) has the molecular formula C36H39ClN4O8S and a molecular weight of 723.25 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide.
| Compound Name | 2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 133201072 |
| Molecular Formula | C36H39ClN4O8S |
| Molecular Weight | 723.25 g/mol |
| Exact Mass | 722.22 |
| IUPAC Name | 2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H39ClN4O8S/c1-5-18-38-36(43)33(20-26-10-7-6-8-11-26)39(23-27-12-9-13-29(19-27)48-3)35(42)24-40(32-21-28(37)15-17-34(32)49-4)50(46,47)30-16-14-25(2)31(22-30)41(44)45/h6-17,19,21-22,33H,5,18,20,23-24H2,1-4H3,(H,38,43) |
| InChIKey | XXPJSNHHHWFWBE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.25 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|