C37H41ClN4O7S — CID 125110513
(2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 125110513) has the molecular formula C37H41ClN4O7S and a molecular weight of 721.28 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125110513 |
| Molecular Formula | C37H41ClN4O7S |
| Molecular Weight | 721.28 g/mol |
| Exact Mass | 720.24 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H41ClN4O7S/c1-6-27(4)39-37(44)34(20-28-12-8-7-9-13-28)40(23-29-14-10-11-25(2)19-29)36(43)24-41(33-21-30(38)16-18-35(33)49-5)50(47,48)31-17-15-26(3)32(22-31)42(45)46/h7-19,21-22,27,34H,6,20,23-24H2,1-5H3,(H,39,44)/t27-,34-/m0/s1 |
| InChIKey | UPKNRKUIYOPUEA-FOPBOCKXSA-N |
| XLogP | 6.62 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.28 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|