C36H38BrClN4O7S — CID 100667919
(2S)-2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100667919) has the molecular formula C36H38BrClN4O7S and a molecular weight of 786.15 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100667919 |
| Molecular Formula | C36H38BrClN4O7S |
| Molecular Weight | 786.15 g/mol |
| Exact Mass | 784.13 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H38BrClN4O7S/c1-4-5-18-39-36(44)33(20-26-10-7-6-8-11-26)40(23-27-12-9-13-28(37)19-27)35(43)24-41(32-21-29(38)15-17-34(32)49-3)50(47,48)30-16-14-25(2)31(22-30)42(45)46/h6-17,19,21-22,33H,4-5,18,20,23-24H2,1-3H3,(H,39,44)/t33-/m0/s1 |
| InChIKey | GDWNRCSSCKIXDA-XIFFEERXSA-N |
| XLogP | 7.08 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.15 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|