C30H34BrClN4O7S — CID 133151926
2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133151926) has the molecular formula C30H34BrClN4O7S and a molecular weight of 710.05 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151926 |
| Molecular Formula | C30H34BrClN4O7S |
| Molecular Weight | 710.05 g/mol |
| Exact Mass | 708.10 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34BrClN4O7S/c1-5-6-14-33-30(38)21(3)34(18-22-8-7-9-23(31)15-22)29(37)19-35(27-16-24(32)11-13-28(27)43-4)44(41,42)25-12-10-20(2)26(17-25)36(39)40/h7-13,15-17,21H,5-6,14,18-19H2,1-4H3,(H,33,38) |
| InChIKey | SDBNOTMAOVTWCW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.05 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|