C32H39ClN4O7S — CID 132758073
N-butyl-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 132758073) has the molecular formula C32H39ClN4O7S and a molecular weight of 659.21 g/mol. Its IUPAC name is N-butyl-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butyl-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132758073 |
| Molecular Formula | C32H39ClN4O7S |
| Molecular Weight | 659.21 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | N-butyl-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(CCc1ccccc1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H39ClN4O7S/c1-5-7-18-34-32(39)27(6-2)35(19-17-24-11-9-8-10-12-24)31(38)22-36(29-20-25(33)14-16-30(29)44-4)45(42,43)26-15-13-23(3)28(21-26)37(40)41/h8-16,20-21,27H,5-7,17-19,22H2,1-4H3,(H,34,39) |
| InChIKey | WKDDARYJAQJGTL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|