C29H31Cl3N4O7S — CID 100513468
(2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-propylpropanamide (PubChem CID 100513468) has the molecular formula C29H31Cl3N4O7S and a molecular weight of 686.01 g/mol. Its IUPAC name is (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-propylpropanamide.
| Compound Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 100513468 |
| Molecular Formula | C29H31Cl3N4O7S |
| Molecular Weight | 686.01 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H31Cl3N4O7S/c1-5-13-33-29(38)19(3)34(16-22-23(31)7-6-8-24(22)32)28(37)17-35(26-14-20(30)10-12-27(26)43-4)44(41,42)21-11-9-18(2)25(15-21)36(39)40/h6-12,14-15,19H,5,13,16-17H2,1-4H3,(H,33,38)/t19-/m0/s1 |
| InChIKey | RBJWZMSVMMZKEJ-IBGZPJMESA-N |
| XLogP | 6.01 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.01 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|