C31H37ClN4O7S — CID 125066864
(2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 125066864) has the molecular formula C31H37ClN4O7S and a molecular weight of 645.18 g/mol. Its IUPAC name is (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 125066864 |
| Molecular Formula | C31H37ClN4O7S |
| Molecular Weight | 645.18 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N(Cc1ccc(C)cc1)[C@H](C)C(=O)NCC(C)C)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H37ClN4O7S/c1-20(2)17-33-31(38)23(5)34(18-24-10-7-21(3)8-11-24)30(37)19-35(28-15-25(32)12-14-29(28)43-6)44(41,42)26-13-9-22(4)27(16-26)36(39)40/h7-16,20,23H,17-19H2,1-6H3,(H,33,38)/t23-/m1/s1 |
| InChIKey | BLHVWWIJXUFUAY-HSZRJFAPSA-N |
| XLogP | 5.26 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|