C29H32Cl2N4O7S — CID 132698339
2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylpropanamide (PubChem CID 132698339) has the molecular formula C29H32Cl2N4O7S and a molecular weight of 651.57 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylpropanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 132698339 |
| Molecular Formula | C29H32Cl2N4O7S |
| Molecular Weight | 651.57 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H32Cl2N4O7S/c1-5-15-32-29(37)20(3)33(17-24-25(30)7-6-8-26(24)31)28(36)18-34(21-10-12-22(42-4)13-11-21)43(40,41)23-14-9-19(2)27(16-23)35(38)39/h6-14,16,20H,5,15,17-18H2,1-4H3,(H,32,37) |
| InChIKey | CXLLZHVSJRWCBO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|