C30H34Cl2N4O7S — CID 132698552
2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide (PubChem CID 132698552) has the molecular formula C30H34Cl2N4O7S and a molecular weight of 665.60 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132698552 |
| Molecular Formula | C30H34Cl2N4O7S |
| Molecular Weight | 665.60 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34Cl2N4O7S/c1-5-16-33-30(38)27(6-2)34(18-24-25(31)8-7-9-26(24)32)29(37)19-35(21-11-13-22(43-4)14-12-21)44(41,42)23-15-10-20(3)28(17-23)36(39)40/h7-15,17,27H,5-6,16,18-19H2,1-4H3,(H,33,38) |
| InChIKey | CQICUSIKITXHKA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|