C31H36Cl2N4O7S — CID 125104930
(2S)-N-[(2R)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]butanamide (PubChem CID 125104930) has the molecular formula C31H36Cl2N4O7S and a molecular weight of 679.62 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]butanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 125104930 |
| Molecular Formula | C31H36Cl2N4O7S |
| Molecular Weight | 679.62 g/mol |
| Exact Mass | 678.17 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]butanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](CC)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H36Cl2N4O7S/c1-6-21(4)34-31(39)28(7-2)35(18-25-26(32)9-8-10-27(25)33)30(38)19-36(22-12-14-23(44-5)15-13-22)45(42,43)24-16-11-20(3)29(17-24)37(40)41/h8-17,21,28H,6-7,18-19H2,1-5H3,(H,34,39)/t21-,28+/m1/s1 |
| InChIKey | YGOKSIGJPLDVAZ-PIKZIKFNSA-N |
| XLogP | 6.14 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|