C31H38N4O8S — CID 100614892
(2R)-N-[(2R)-butan-2-yl]-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 100614892) has the molecular formula C31H38N4O8S and a molecular weight of 626.73 g/mol. Its IUPAC name is (2R)-N-[(2R)-butan-2-yl]-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-[(2R)-butan-2-yl]-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100614892 |
| Molecular Formula | C31H38N4O8S |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | (2R)-N-[(2R)-butan-2-yl]-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H](C)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H38N4O8S/c1-7-22(3)32-31(37)23(4)33(19-24-9-13-26(42-5)14-10-24)30(36)20-34(25-11-15-27(43-6)16-12-25)44(40,41)28-17-8-21(2)29(18-28)35(38)39/h8-18,22-23H,7,19-20H2,1-6H3,(H,32,37)/t22-,23-/m1/s1 |
| InChIKey | XJANODMGWKSTAP-DHIUTWEWSA-N |
| XLogP | 4.45 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|