C34H42N4O8S — CID 100597145
(2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]butanamide (PubChem CID 100597145) has the molecular formula C34H42N4O8S and a molecular weight of 666.80 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100597145 |
| Molecular Formula | C34H42N4O8S |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H42N4O8S/c1-5-31(34(40)35-26-9-7-6-8-10-26)36(22-25-12-16-28(45-3)17-13-25)33(39)23-37(27-14-18-29(46-4)19-15-27)47(43,44)30-20-11-24(2)32(21-30)38(41)42/h11-21,26,31H,5-10,22-23H2,1-4H3,(H,35,40)/t31-/m1/s1 |
| InChIKey | TVSUOMGIPXRLOM-WJOKGBTCSA-N |
| XLogP | 5.37 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|