C34H42N4O7S — CID 132643458
N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 132643458) has the molecular formula C34H42N4O7S and a molecular weight of 650.80 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132643458 |
| Molecular Formula | C34H42N4O7S |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H42N4O7S/c1-4-31(34(40)35-27-13-9-6-10-14-27)36(22-21-26-11-7-5-8-12-26)33(39)24-37(28-16-18-29(45-3)19-17-28)46(43,44)30-20-15-25(2)32(23-30)38(41)42/h5,7-8,11-12,15-20,23,27,31H,4,6,9-10,13-14,21-22,24H2,1-3H3,(H,35,40) |
| InChIKey | XKCHBWRNXQUSII-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|