C38H42N4O7S — CID 125090904
(2R)-N-cyclopentyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 125090904) has the molecular formula C38H42N4O7S and a molecular weight of 698.84 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125090904 |
| Molecular Formula | C38H42N4O7S |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2cccc(C)c2)[C@H](Cc2ccccc2)C(=O)NC2CCCC2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C38H42N4O7S/c1-27-10-9-13-30(22-27)25-40(36(23-29-11-5-4-6-12-29)38(44)39-31-14-7-8-15-31)37(43)26-41(32-17-19-33(49-3)20-18-32)50(47,48)34-21-16-28(2)35(24-34)42(45)46/h4-6,9-13,16-22,24,31,36H,7-8,14-15,23,25-26H2,1-3H3,(H,39,44)/t36-/m1/s1 |
| InChIKey | IDGVWROTMKIPDN-PSXMRANNSA-N |
| XLogP | 6.11 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|