C37H42N4O7S — CID 100594453
(2S)-N-butyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100594453) has the molecular formula C37H42N4O7S and a molecular weight of 686.83 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100594453 |
| Molecular Formula | C37H42N4O7S |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H42N4O7S/c1-5-6-21-38-37(43)35(23-29-12-8-7-9-13-29)39(25-30-14-10-11-27(2)22-30)36(42)26-40(31-16-18-32(48-4)19-17-31)49(46,47)33-20-15-28(3)34(24-33)41(44)45/h7-20,22,24,35H,5-6,21,23,25-26H2,1-4H3,(H,38,43)/t35-/m0/s1 |
| InChIKey | ZOPZYOFRKAQSCQ-DHUJRADRSA-N |
| XLogP | 5.97 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|