C36H39FN4O7S — CID 100646784
(2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100646784) has the molecular formula C36H39FN4O7S and a molecular weight of 690.79 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100646784 |
| Molecular Formula | C36H39FN4O7S |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | (2R)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H39FN4O7S/c1-4-5-21-38-36(43)34(22-27-11-7-6-8-12-27)39(24-28-13-9-10-14-32(28)37)35(42)25-40(29-16-18-30(48-3)19-17-29)49(46,47)31-20-15-26(2)33(23-31)41(44)45/h6-20,23,34H,4-5,21-22,24-25H2,1-3H3,(H,38,43)/t34-/m1/s1 |
| InChIKey | GVQYVANCTVWOQA-UUWRZZSWSA-N |
| XLogP | 5.80 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|